C21H21ClN2O4S — CID 22418104
5-chloro-N-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]propyl]-2-methoxybenzamide (PubChem CID 22418104) has the molecular formula C21H21ClN2O4S and a molecular weight of 432.93 g/mol. Its IUPAC name is 5-chloro-N-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]propyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]propyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 22418104 |
| Molecular Formula | C21H21ClN2O4S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 5-chloro-N-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]propyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCCc1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C21H21ClN2O4S/c1-28-17-9-8-15(22)12-16(17)19(25)23-10-2-3-13-4-6-14(7-5-13)11-18-20(26)24-21(27)29-18/h4-9,12,18H,2-3,10-11H2,1H3,(H,23,25)(H,24,26,27) |
| InChIKey | RLAMNWPGSXZEHB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|