C21H23N3O4S — CID 15487783
N-[[4-(dimethylamino)phenyl]methyl]-5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxybenzamide (PubChem CID 15487783) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxybenzamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 15487783 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methoxybenzamide |
| SMILES | COc1ccc(CC2SC(=O)NC2=O)cc1C(=O)NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H23N3O4S/c1-24(2)15-7-4-13(5-8-15)12-22-19(25)16-10-14(6-9-17(16)28-3)11-18-20(26)23-21(27)29-18/h4-10,18H,11-12H2,1-3H3,(H,22,25)(H,23,26,27) |
| InChIKey | LSECGHMGLXPYAT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|