C26H22N2O5S2 — CID 15751810
5-[[4-[2-(5-methyl-2-naphthalen-2-yl-1,3-oxazol-4-yl)ethylsulfonyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 15751810) has the molecular formula C26H22N2O5S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 5-[[4-[2-(5-methyl-2-naphthalen-2-yl-1,3-oxazol-4-yl)ethylsulfonyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-(5-methyl-2-naphthalen-2-yl-1,3-oxazol-4-yl)ethylsulfonyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 15751810 |
| Molecular Formula | C26H22N2O5S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 5-[[4-[2-(5-methyl-2-naphthalen-2-yl-1,3-oxazol-4-yl)ethylsulfonyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1oc(-c2ccc3ccccc3c2)nc1CCS(=O)(=O)c1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C26H22N2O5S2/c1-16-22(27-25(33-16)20-9-8-18-4-2-3-5-19(18)15-20)12-13-35(31,32)21-10-6-17(7-11-21)14-23-24(29)28-26(30)34-23/h2-11,15,23H,12-14H2,1H3,(H,28,29,30) |
| InChIKey | CLAFREQRJLTFQQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|