C25H26N6O8S2 — CID 174880221
carbamoylsulfamoylurea;5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 174880221) has the molecular formula C25H26N6O8S2 and a molecular weight of 602.65 g/mol. Its IUPAC name is carbamoylsulfamoylurea;5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | carbamoylsulfamoylurea;5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 174880221 |
| Molecular Formula | C25H26N6O8S2 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | carbamoylsulfamoylurea;5-[[4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propanoyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1CCC(=O)c1ccc(CC2SC(=O)NC2=O)cc1.NC(=O)NS(=O)(=O)NC(N)=O |
| InChI | InChI=1S/C23H20N2O4S.C2H6N4O4S/c1-14-18(24-22(29-14)17-5-3-2-4-6-17)11-12-19(26)16-9-7-15(8-10-16)13-20-21(27)25-23(28)30-20;3-1(7)5-11(9,10)6-2(4)8/h2-10,20H,11-13H2,1H3,(H,25,27,28);(H3,3,5,7)(H3,4,6,8) |
| InChIKey | POFUFGHWZNBXJU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 233.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|