C20H20N2O3S — CID 15751804
5-[[4-[3-(5-ethyl-2-pyridinyl)propanoyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 15751804) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 5-[[4-[3-(5-ethyl-2-pyridinyl)propanoyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[3-(5-ethyl-2-pyridinyl)propanoyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 15751804 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 5-[[4-[3-(5-ethyl-2-pyridinyl)propanoyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1ccc(CCC(=O)c2ccc(CC3SC(=O)NC3=O)cc2)nc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-2-13-5-8-16(21-12-13)9-10-17(23)15-6-3-14(4-7-15)11-18-19(24)22-20(25)26-18/h3-8,12,18H,2,9-11H2,1H3,(H,22,24,25) |
| InChIKey | FUNMWBQIOZTCKY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|