C26H24N2O5S — CID 118430002
1-[6-[2-[4-[[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]phenoxy]ethyl]-3-pyridinyl]ethyl benzoate (PubChem CID 118430002) has the molecular formula C26H24N2O5S and a molecular weight of 476.55 g/mol. Its IUPAC name is 1-[6-[2-[4-[[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]phenoxy]ethyl]-3-pyridinyl]ethyl benzoate.
| Compound Name | 1-[6-[2-[4-[[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]phenoxy]ethyl]-3-pyridinyl]ethyl benzoate |
|---|---|
| PubChem CID | 118430002 |
| Molecular Formula | C26H24N2O5S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 1-[6-[2-[4-[[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]phenoxy]ethyl]-3-pyridinyl]ethyl benzoate |
| SMILES | CC(OC(=O)c1ccccc1)c1ccc(CCOc2ccc(C[C@@H]3SC(=O)NC3=O)cc2)nc1 |
| InChI | InChI=1S/C26H24N2O5S/c1-17(33-25(30)19-5-3-2-4-6-19)20-9-10-21(27-16-20)13-14-32-22-11-7-18(8-12-22)15-23-24(29)28-26(31)34-23/h2-12,16-17,23H,13-15H2,1H3,(H,28,29,31)/t17?,23-/m0/s1 |
| InChIKey | CVQGYVPPRDVDTP-VXLWULRPSA-N |
| XLogP | 4.52 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|