C22H24N2O5S — CID 19391008
1-[6-[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]ethyl]-3-pyridinyl]ethyl propanoate (PubChem CID 19391008) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is 1-[6-[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]ethyl]-3-pyridinyl]ethyl propanoate.
| Compound Name | 1-[6-[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]ethyl]-3-pyridinyl]ethyl propanoate |
|---|---|
| PubChem CID | 19391008 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1-[6-[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]ethyl]-3-pyridinyl]ethyl propanoate |
| SMILES | CCC(=O)OC(C)c1ccc(CCOc2ccc(CC3NC(=O)SC3=O)cc2)nc1 |
| InChI | InChI=1S/C22H24N2O5S/c1-3-20(25)29-14(2)16-6-7-17(23-13-16)10-11-28-18-8-4-15(5-9-18)12-19-21(26)30-22(27)24-19/h4-9,13-14,19H,3,10-12H2,1-2H3,(H,24,27) |
| InChIKey | JSHBTYGZQWWFDR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|