C20H25NO3 — CID 53249782
ethyl 2-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanoate (PubChem CID 53249782) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is ethyl 2-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanoate.
| Compound Name | ethyl 2-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 53249782 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | ethyl 2-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(C)c1ccc(OCCc2ccc(CC)cn2)cc1 |
| InChI | InChI=1S/C20H25NO3/c1-4-16-6-9-18(21-14-16)12-13-24-19-10-7-17(8-11-19)15(3)20(22)23-5-2/h6-11,14-15H,4-5,12-13H2,1-3H3 |
| InChIKey | HYJULJWKUCUHPF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |