C18H18BrNO3 — CID 141245555
2-bromo-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 141245555) has the molecular formula C18H18BrNO3 and a molecular weight of 376.25 g/mol. Its IUPAC name is 2-bromo-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 2-bromo-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141245555 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-bromo-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | CCc1ccc(CCOc2ccc(C=C(Br)C(=O)O)cc2)nc1 |
| InChI | InChI=1S/C18H18BrNO3/c1-2-13-3-6-15(20-12-13)9-10-23-16-7-4-14(5-8-16)11-17(19)18(21)22/h3-8,11-12H,2,9-10H2,1H3,(H,21,22) |
| InChIKey | DALOSJNSUOGPQX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|