C22H20Cl2N2O — CID 139218679
N-(3,4-dichlorophenyl)-1-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methanimine (PubChem CID 139218679) has the molecular formula C22H20Cl2N2O and a molecular weight of 399.32 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methanimine.
| Compound Name | N-(3,4-dichlorophenyl)-1-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 139218679 |
| Molecular Formula | C22H20Cl2N2O |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methanimine |
| SMILES | CCc1ccc(CCOc2ccc(/C=N/c3ccc(Cl)c(Cl)c3)cc2)nc1 |
| InChI | InChI=1S/C22H20Cl2N2O/c1-2-16-3-6-18(25-14-16)11-12-27-20-8-4-17(5-9-20)15-26-19-7-10-21(23)22(24)13-19/h3-10,13-15H,2,11-12H2,1H3/b26-15+ |
| InChIKey | HQRODZGOAINBTE-CVKSISIWSA-N |
| XLogP | 6.32 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|