C23H23ClN2O — CID 139218684
N-(3-chloro-4-methylphenyl)-1-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methanimine (PubChem CID 139218684) has the molecular formula C23H23ClN2O and a molecular weight of 378.90 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-1-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methanimine.
| Compound Name | N-(3-chloro-4-methylphenyl)-1-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 139218684 |
| Molecular Formula | C23H23ClN2O |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-1-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methanimine |
| SMILES | CCc1ccc(CCOc2ccc(/C=N/c3ccc(C)c(Cl)c3)cc2)nc1 |
| InChI | InChI=1S/C23H23ClN2O/c1-3-18-5-9-20(25-15-18)12-13-27-22-10-6-19(7-11-22)16-26-21-8-4-17(2)23(24)14-21/h4-11,14-16H,3,12-13H2,1-2H3/b26-16+ |
| InChIKey | NAWUFEVUZAECOB-WGOQTCKBSA-N |
| XLogP | 5.98 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|