C23H32N2O3S — CID 142844864
ethane;(Z)-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-N-methyl-2-methylsulfanylprop-2-enamide;formaldehyde (PubChem CID 142844864) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is ethane;(Z)-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-N-methyl-2-methylsulfanylprop-2-enamide;formaldehyde.
| Compound Name | ethane;(Z)-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-N-methyl-2-methylsulfanylprop-2-enamide;formaldehyde |
|---|---|
| PubChem CID | 142844864 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | ethane;(Z)-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-N-methyl-2-methylsulfanylprop-2-enamide;formaldehyde |
| SMILES | C=O.CC.CCc1ccc(CCOc2ccc(/C=C(\SC)C(=O)NC)cc2)nc1 |
| InChI | InChI=1S/C20H24N2O2S.C2H6.CH2O/c1-4-15-5-8-17(22-14-15)11-12-24-18-9-6-16(7-10-18)13-19(25-3)20(23)21-2;2*1-2/h5-10,13-14H,4,11-12H2,1-3H3,(H,21,23);1-2H3;1H2/b19-13-;; |
| InChIKey | NZTVFEYYIULKFJ-SJNXHXLPSA-N |
| XLogP | 4.56 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|