C15H18BrNO5S — CID 131698614
2-[2-(4-bromophenoxy)ethyl]-5-ethylpyridine;sulfuric acid (PubChem CID 131698614) has the molecular formula C15H18BrNO5S and a molecular weight of 404.28 g/mol. Its IUPAC name is 2-[2-(4-bromophenoxy)ethyl]-5-ethylpyridine;sulfuric acid.
| Compound Name | 2-[2-(4-bromophenoxy)ethyl]-5-ethylpyridine;sulfuric acid |
|---|---|
| PubChem CID | 131698614 |
| Molecular Formula | C15H18BrNO5S |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 2-[2-(4-bromophenoxy)ethyl]-5-ethylpyridine;sulfuric acid |
| SMILES | CCc1ccc(CCOc2ccc(Br)cc2)nc1.O=S(=O)(O)O |
| InChI | InChI=1S/C15H16BrNO.H2O4S/c1-2-12-3-6-14(17-11-12)9-10-18-15-7-4-13(16)5-8-15;1-5(2,3)4/h3-8,11H,2,9-10H2,1H3;(H2,1,2,3,4) |
| InChIKey | LZXMETSCDKHYQD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|