C23H31NO6S — CID 87611190
butyl 3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-2-methylsulfonyloxypropanoate (PubChem CID 87611190) has the molecular formula C23H31NO6S and a molecular weight of 449.57 g/mol. Its IUPAC name is butyl 3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-2-methylsulfonyloxypropanoate.
| Compound Name | butyl 3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-2-methylsulfonyloxypropanoate |
|---|---|
| PubChem CID | 87611190 |
| Molecular Formula | C23H31NO6S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | butyl 3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]-2-methylsulfonyloxypropanoate |
| SMILES | CCCCOC(=O)C(Cc1ccc(OCCc2ccc(CC)cn2)cc1)OS(C)(=O)=O |
| InChI | InChI=1S/C23H31NO6S/c1-4-6-14-29-23(25)22(30-31(3,26)27)16-19-8-11-21(12-9-19)28-15-13-20-10-7-18(5-2)17-24-20/h7-12,17,22H,4-6,13-16H2,1-3H3 |
| InChIKey | TWMKWGNLKGZLLR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|