C20H25NO4 — CID 67367096
(2R)-2-ethoxy-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanoic acid (PubChem CID 67367096) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (2R)-2-ethoxy-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanoic acid.
| Compound Name | (2R)-2-ethoxy-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67367096 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (2R)-2-ethoxy-3-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]propanoic acid |
| SMILES | CCO[C@H](Cc1ccc(OCCc2ccc(CC)cn2)cc1)C(=O)O |
| InChI | InChI=1S/C20H25NO4/c1-3-15-5-8-17(21-14-15)11-12-25-18-9-6-16(7-10-18)13-19(20(22)23)24-4-2/h5-10,14,19H,3-4,11-13H2,1-2H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | STYOXUJHHXIHSL-LJQANCHMSA-N |
| XLogP | 3.30 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |