C15H17BrNO5S- — CID 171030580
2-[2-(4-bromophenoxy)ethyl]-5-ethylpyridine;hydroxy sulfite (PubChem CID 171030580) has the molecular formula C15H17BrNO5S- and a molecular weight of 403.27 g/mol. Its IUPAC name is 2-[2-(4-bromophenoxy)ethyl]-5-ethylpyridine;hydroxy sulfite.
| Compound Name | 2-[2-(4-bromophenoxy)ethyl]-5-ethylpyridine;hydroxy sulfite |
|---|---|
| PubChem CID | 171030580 |
| Molecular Formula | C15H17BrNO5S- |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 2-[2-(4-bromophenoxy)ethyl]-5-ethylpyridine;hydroxy sulfite |
| SMILES | CCc1ccc(CCOc2ccc(Br)cc2)nc1.O=S([O-])OO |
| InChI | InChI=1S/C15H16BrNO.H2O4S/c1-2-12-3-6-14(17-11-12)9-10-18-15-7-4-13(16)5-8-15;1-4-5(2)3/h3-8,11H,2,9-10H2,1H3;1H,(H,2,3)/p-1 |
| InChIKey | DQQXOTABRYOFCB-UHFFFAOYSA-M |
| XLogP | 3.30 |
| TPSA | 91.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|