C19H19HgN2O3S — CID 163894147
[(5S)-5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]mercury (PubChem CID 163894147) has the molecular formula C19H19HgN2O3S and a molecular weight of 556.03 g/mol. Its IUPAC name is [(5S)-5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]mercury.
| Compound Name | [(5S)-5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]mercury |
|---|---|
| PubChem CID | 163894147 |
| Molecular Formula | C19H19HgN2O3S |
| Molecular Weight | 556.03 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | [(5S)-5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-5-yl]mercury |
| SMILES | CCc1ccc(CCOc2ccc(C[C@@]3([Hg])SC(=O)NC3=O)cc2)nc1 |
| InChI | InChI=1S/C19H19N2O3S.Hg/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17;/h3-8,12H,2,9-11H2,1H3,(H,21,22,23); |
| InChIKey | QEDGPWKAPDEHQF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.03 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|