C19H21N2O6PS — CID 56947425
[5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]phosphonic acid (PubChem CID 56947425) has the molecular formula C19H21N2O6PS and a molecular weight of 436.43 g/mol. Its IUPAC name is [5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]phosphonic acid.
| Compound Name | [5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 56947425 |
| Molecular Formula | C19H21N2O6PS |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | [5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]phosphonic acid |
| SMILES | CCc1ccc(CCOc2ccc(CC3SC(=O)N(P(=O)(O)O)C3=O)cc2)nc1 |
| InChI | InChI=1S/C19H21N2O6PS/c1-2-13-3-6-15(20-12-13)9-10-27-16-7-4-14(5-8-16)11-17-18(22)21(19(23)29-17)28(24,25)26/h3-8,12,17H,2,9-11H2,1H3,(H2,24,25,26) |
| InChIKey | HRPAGTAAYVOXKP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|