C24H28N2O5S — CID 56947424
tert-butyl 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-3-carboxylate (PubChem CID 56947424) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is tert-butyl 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 56947424 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | tert-butyl 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-dioxo-1,3-thiazolidine-3-carboxylate |
| SMILES | CCc1ccc(CCOc2ccc(CC3SC(=O)N(C(=O)OC(C)(C)C)C3=O)cc2)nc1 |
| InChI | InChI=1S/C24H28N2O5S/c1-5-16-6-9-18(25-15-16)12-13-30-19-10-7-17(8-11-19)14-20-21(27)26(23(29)32-20)22(28)31-24(2,3)4/h6-11,15,20H,5,12-14H2,1-4H3 |
| InChIKey | SDOJNOWHHQINDT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|