C23H28N2O5S — CID 144721223
1-[6-[2-[4-(3-formamido-2-methylsulfanyl-3-oxopropyl)phenoxy]ethyl]-3-pyridinyl]ethyl propanoate (PubChem CID 144721223) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is 1-[6-[2-[4-(3-formamido-2-methylsulfanyl-3-oxopropyl)phenoxy]ethyl]-3-pyridinyl]ethyl propanoate.
| Compound Name | 1-[6-[2-[4-(3-formamido-2-methylsulfanyl-3-oxopropyl)phenoxy]ethyl]-3-pyridinyl]ethyl propanoate |
|---|---|
| PubChem CID | 144721223 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-[6-[2-[4-(3-formamido-2-methylsulfanyl-3-oxopropyl)phenoxy]ethyl]-3-pyridinyl]ethyl propanoate |
| SMILES | CCC(=O)OC(C)c1ccc(CCOc2ccc(CC(SC)C(=O)NC=O)cc2)nc1 |
| InChI | InChI=1S/C23H28N2O5S/c1-4-22(27)30-16(2)18-7-8-19(24-14-18)11-12-29-20-9-5-17(6-10-20)13-21(31-3)23(28)25-15-26/h5-10,14-16,21H,4,11-13H2,1-3H3,(H,25,26,28) |
| InChIKey | XUFKZWSWNIJNTB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|