C11H11NO3S — CID 68809970
4-[(4-methoxyphenyl)methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 68809970) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[(4-methoxyphenyl)methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 68809970 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 4-[(4-methoxyphenyl)methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | COc1ccc(CC2NC(=O)SC2=O)cc1 |
| InChI | InChI=1S/C11H11NO3S/c1-15-8-4-2-7(3-5-8)6-9-10(13)16-11(14)12-9/h2-5,9H,6H2,1H3,(H,12,14) |
| InChIKey | OFNFKWYYJQLCFZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|