C20H16N2O3S2 — CID 18687652
4-[[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 18687652) has the molecular formula C20H16N2O3S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-[[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 18687652 |
| Molecular Formula | C20H16N2O3S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-[[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | O=C1NC(Cc2ccc(OCc3nc(-c4ccccc4)cs3)cc2)C(=O)S1 |
| InChI | InChI=1S/C20H16N2O3S2/c23-19-16(22-20(24)27-19)10-13-6-8-15(9-7-13)25-11-18-21-17(12-26-18)14-4-2-1-3-5-14/h1-9,12,16H,10-11H2,(H,22,24) |
| InChIKey | VXZZDWLXBBTCGS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|