C31H28N2O4S — CID 10649747
2-[cyclohexyl-[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methoxy]isoindole-1,3-dione (PubChem CID 10649747) has the molecular formula C31H28N2O4S and a molecular weight of 524.64 g/mol. Its IUPAC name is 2-[cyclohexyl-[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-[cyclohexyl-[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10649747 |
| Molecular Formula | C31H28N2O4S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-[cyclohexyl-[4-[(4-phenyl-1,3-thiazol-2-yl)methoxy]phenyl]methoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OC(c1ccc(OCc2nc(-c3ccccc3)cs2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C31H28N2O4S/c34-30-25-13-7-8-14-26(25)31(35)33(30)37-29(22-11-5-2-6-12-22)23-15-17-24(18-16-23)36-19-28-32-27(20-38-28)21-9-3-1-4-10-21/h1,3-4,7-10,13-18,20,22,29H,2,5-6,11-12,19H2 |
| InChIKey | XYYMDILPAXSQTQ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|