C26H32N2O2S — CID 10789082
O-[cyclohexyl-[4-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]methoxy]phenyl]methyl]hydroxylamine (PubChem CID 10789082) has the molecular formula C26H32N2O2S and a molecular weight of 436.62 g/mol. Its IUPAC name is O-[cyclohexyl-[4-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]methoxy]phenyl]methyl]hydroxylamine.
| Compound Name | O-[cyclohexyl-[4-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]methoxy]phenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 10789082 |
| Molecular Formula | C26H32N2O2S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | O-[cyclohexyl-[4-[[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]methoxy]phenyl]methyl]hydroxylamine |
| SMILES | CC(C)c1ccc(-c2csc(COc3ccc(C(ON)C4CCCCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C26H32N2O2S/c1-18(2)19-8-10-20(11-9-19)24-17-31-25(28-24)16-29-23-14-12-22(13-15-23)26(30-27)21-6-4-3-5-7-21/h8-15,17-18,21,26H,3-7,16,27H2,1-2H3 |
| InChIKey | FWIJIABABOURAS-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|