C17H22N2S — CID 61336894
1-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]cyclopentan-1-amine (PubChem CID 61336894) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 1-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]cyclopentan-1-amine.
| Compound Name | 1-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 61336894 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]cyclopentan-1-amine |
| SMILES | CC(C)c1ccc(-c2csc(C3(N)CCCC3)n2)cc1 |
| InChI | InChI=1S/C17H22N2S/c1-12(2)13-5-7-14(8-6-13)15-11-20-16(19-15)17(18)9-3-4-10-17/h5-8,11-12H,3-4,9-10,18H2,1-2H3 |
| InChIKey | VRRQVYNHAZADAU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |