C18H16N2S — CID 134081875
1-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]cyclopropan-1-amine (PubChem CID 134081875) has the molecular formula C18H16N2S and a molecular weight of 292.41 g/mol. Its IUPAC name is 1-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]cyclopropan-1-amine.
| Compound Name | 1-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 134081875 |
| Molecular Formula | C18H16N2S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]cyclopropan-1-amine |
| SMILES | NC1(c2nc(-c3ccc(-c4ccccc4)cc3)cs2)CC1 |
| InChI | InChI=1S/C18H16N2S/c19-18(10-11-18)17-20-16(12-21-17)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-9,12H,10-11,19H2 |
| InChIKey | HABKVOVQDXMNNP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |