C15H18N2O2S2 — CID 61336316
1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]cyclopentan-1-amine (PubChem CID 61336316) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]cyclopentan-1-amine.
| Compound Name | 1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 61336316 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 1-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]cyclopentan-1-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2csc(C3(N)CCCC3)n2)cc1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-21(18,19)12-6-4-11(5-7-12)13-10-20-14(17-13)15(16)8-2-3-9-15/h4-7,10H,2-3,8-9,16H2,1H3 |
| InChIKey | AZUBNLUUQYBQOY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |