C26H37N3O3S — CID 42879988
N-[2-(hexanoylamino)cyclohexyl]-2-[(4-propan-2-ylphenoxy)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 42879988) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is N-[2-(hexanoylamino)cyclohexyl]-2-[(4-propan-2-ylphenoxy)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(hexanoylamino)cyclohexyl]-2-[(4-propan-2-ylphenoxy)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 42879988 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | N-[2-(hexanoylamino)cyclohexyl]-2-[(4-propan-2-ylphenoxy)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCC(=O)NC1CCCCC1NC(=O)c1csc(COc2ccc(C(C)C)cc2)n1 |
| InChI | InChI=1S/C26H37N3O3S/c1-4-5-6-11-24(30)27-21-9-7-8-10-22(21)29-26(31)23-17-33-25(28-23)16-32-20-14-12-19(13-15-20)18(2)3/h12-15,17-18,21-22H,4-11,16H2,1-3H3,(H,27,30)(H,29,31) |
| InChIKey | RXDFGUQFNMULJU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|