C22H30N4O3S — CID 93014756
N-[(1S,2R)-2-(butylcarbamoylamino)cyclohexyl]-2-(phenoxymethyl)-1,3-thiazole-4-carboxamide (PubChem CID 93014756) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-[(1S,2R)-2-(butylcarbamoylamino)cyclohexyl]-2-(phenoxymethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(1S,2R)-2-(butylcarbamoylamino)cyclohexyl]-2-(phenoxymethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 93014756 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[(1S,2R)-2-(butylcarbamoylamino)cyclohexyl]-2-(phenoxymethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)N[C@@H]1CCCC[C@@H]1NC(=O)c1csc(COc2ccccc2)n1 |
| InChI | InChI=1S/C22H30N4O3S/c1-2-3-13-23-22(28)26-18-12-8-7-11-17(18)25-21(27)19-15-30-20(24-19)14-29-16-9-5-4-6-10-16/h4-6,9-10,15,17-18H,2-3,7-8,11-14H2,1H3,(H,25,27)(H2,23,26,28)/t17-,18+/m0/s1 |
| InChIKey | JLSSHCGVPUIUMM-ZWKOTPCHSA-N |
| XLogP | 3.86 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|