C24H34N4O3S — CID 93014856
N-[(1S,2R)-2-(butylcarbamoylamino)cyclohexyl]-2-[(3,5-dimethylphenoxy)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 93014856) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is N-[(1S,2R)-2-(butylcarbamoylamino)cyclohexyl]-2-[(3,5-dimethylphenoxy)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(1S,2R)-2-(butylcarbamoylamino)cyclohexyl]-2-[(3,5-dimethylphenoxy)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 93014856 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N-[(1S,2R)-2-(butylcarbamoylamino)cyclohexyl]-2-[(3,5-dimethylphenoxy)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)N[C@@H]1CCCC[C@@H]1NC(=O)c1csc(COc2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C24H34N4O3S/c1-4-5-10-25-24(30)28-20-9-7-6-8-19(20)27-23(29)21-15-32-22(26-21)14-31-18-12-16(2)11-17(3)13-18/h11-13,15,19-20H,4-10,14H2,1-3H3,(H,27,29)(H2,25,28,30)/t19-,20+/m0/s1 |
| InChIKey | ROBQAVSPKCCVPC-VQTJNVASSA-N |
| XLogP | 4.48 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|