C32H41N3O3S — CID 46106047
N-[2-[(4-pentylbenzoyl)amino]cyclohexyl]-2-[(4-propan-2-ylphenoxy)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 46106047) has the molecular formula C32H41N3O3S and a molecular weight of 547.77 g/mol. Its IUPAC name is N-[2-[(4-pentylbenzoyl)amino]cyclohexyl]-2-[(4-propan-2-ylphenoxy)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-[(4-pentylbenzoyl)amino]cyclohexyl]-2-[(4-propan-2-ylphenoxy)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46106047 |
| Molecular Formula | C32H41N3O3S |
| Molecular Weight | 547.77 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | N-[2-[(4-pentylbenzoyl)amino]cyclohexyl]-2-[(4-propan-2-ylphenoxy)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCc1ccc(C(=O)NC2CCCCC2NC(=O)c2csc(COc3ccc(C(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C32H41N3O3S/c1-4-5-6-9-23-12-14-25(15-13-23)31(36)34-27-10-7-8-11-28(27)35-32(37)29-21-39-30(33-29)20-38-26-18-16-24(17-19-26)22(2)3/h12-19,21-22,27-28H,4-11,20H2,1-3H3,(H,34,36)(H,35,37) |
| InChIKey | JGPUBHZRPREOTC-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.77 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|