C20H20N2OS — CID 113229452
4-(4-phenylmethoxyphenyl)-2-pyrrolidin-2-yl-1,3-thiazole (PubChem CID 113229452) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 4-(4-phenylmethoxyphenyl)-2-pyrrolidin-2-yl-1,3-thiazole.
| Compound Name | 4-(4-phenylmethoxyphenyl)-2-pyrrolidin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 113229452 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-(4-phenylmethoxyphenyl)-2-pyrrolidin-2-yl-1,3-thiazole |
| SMILES | c1ccc(COc2ccc(-c3csc(C4CCCN4)n3)cc2)cc1 |
| InChI | InChI=1S/C20H20N2OS/c1-2-5-15(6-3-1)13-23-17-10-8-16(9-11-17)19-14-24-20(22-19)18-7-4-12-21-18/h1-3,5-6,8-11,14,18,21H,4,7,12-13H2 |
| InChIKey | IUBFEDYZDLMXPC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |