C16H21N3S — CID 67356783
N,N-dimethyl-4-(2-piperidin-2-yl-1,3-thiazol-4-yl)aniline (PubChem CID 67356783) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-piperidin-2-yl-1,3-thiazol-4-yl)aniline.
| Compound Name | N,N-dimethyl-4-(2-piperidin-2-yl-1,3-thiazol-4-yl)aniline |
|---|---|
| PubChem CID | 67356783 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N,N-dimethyl-4-(2-piperidin-2-yl-1,3-thiazol-4-yl)aniline |
| SMILES | CN(C)c1ccc(-c2csc(C3CCCCN3)n2)cc1 |
| InChI | InChI=1S/C16H21N3S/c1-19(2)13-8-6-12(7-9-13)15-11-20-16(18-15)14-5-3-4-10-17-14/h6-9,11,14,17H,3-5,10H2,1-2H3 |
| InChIKey | YWXLUGDLAYIBMA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |