C13H20N2S — CID 62634064
4-cyclopentyl-2-piperidin-2-yl-1,3-thiazole (PubChem CID 62634064) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 4-cyclopentyl-2-piperidin-2-yl-1,3-thiazole.
| Compound Name | 4-cyclopentyl-2-piperidin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 62634064 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-cyclopentyl-2-piperidin-2-yl-1,3-thiazole |
| SMILES | c1sc(C2CCCCN2)nc1C1CCCC1 |
| InChI | InChI=1S/C13H20N2S/c1-2-6-10(5-1)12-9-16-13(15-12)11-7-3-4-8-14-11/h9-11,14H,1-8H2 |
| InChIKey | PYESSIIJYHIODX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |