C11H17ClN2O2S — CID 120581948
3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]morpholine;hydrochloride (PubChem CID 120581948) has the molecular formula C11H17ClN2O2S and a molecular weight of 276.79 g/mol. Its IUPAC name is 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]morpholine;hydrochloride.
| Compound Name | 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 120581948 |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-[4-(oxolan-3-yl)-1,3-thiazol-2-yl]morpholine;hydrochloride |
| SMILES | Cl.c1sc(C2COCCN2)nc1C1CCOC1 |
| InChI | InChI=1S/C11H16N2O2S.ClH/c1-3-14-5-8(1)10-7-16-11(13-10)9-6-15-4-2-12-9;/h7-9,12H,1-6H2;1H |
| InChIKey | XCQSFXRFIXWDFB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |