C8H12N2OS — CID 96626970
(3S)-3-(2-methyl-1,3-thiazol-4-yl)morpholine (PubChem CID 96626970) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is (3S)-3-(2-methyl-1,3-thiazol-4-yl)morpholine.
| Compound Name | (3S)-3-(2-methyl-1,3-thiazol-4-yl)morpholine |
|---|---|
| PubChem CID | 96626970 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (3S)-3-(2-methyl-1,3-thiazol-4-yl)morpholine |
| SMILES | Cc1nc([C@H]2COCCN2)cs1 |
| InChI | InChI=1S/C8H12N2OS/c1-6-10-8(5-12-6)7-4-11-3-2-9-7/h5,7,9H,2-4H2,1H3/t7-/m1/s1 |
| InChIKey | OVWMNENIQJRNRP-SSDOTTSWSA-N |
| XLogP | 1.11 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |