C13H14N2OS — CID 83439832
3-(4-phenyl-1,3-thiazol-2-yl)morpholine (PubChem CID 83439832) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is 3-(4-phenyl-1,3-thiazol-2-yl)morpholine.
| Compound Name | 3-(4-phenyl-1,3-thiazol-2-yl)morpholine |
|---|---|
| PubChem CID | 83439832 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-(4-phenyl-1,3-thiazol-2-yl)morpholine |
| SMILES | c1ccc(-c2csc(C3COCCN3)n2)cc1 |
| InChI | InChI=1S/C13H14N2OS/c1-2-4-10(5-3-1)12-9-17-13(15-12)11-8-16-7-6-14-11/h1-5,9,11,14H,6-8H2 |
| InChIKey | WYLRTYVYEPJSMV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |