C14H13F3N2OS — CID 102748231
3-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]morpholine (PubChem CID 102748231) has the molecular formula C14H13F3N2OS and a molecular weight of 314.33 g/mol. Its IUPAC name is 3-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]morpholine.
| Compound Name | 3-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 102748231 |
| Molecular Formula | C14H13F3N2OS |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 3-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]morpholine |
| SMILES | FC(F)(F)c1cccc(-c2csc(C3COCCN3)n2)c1 |
| InChI | InChI=1S/C14H13F3N2OS/c15-14(16,17)10-3-1-2-9(6-10)12-8-21-13(19-12)11-7-20-5-4-18-11/h1-3,6,8,11,18H,4-5,7H2 |
| InChIKey | ASMRCIRUJDHPJQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |