C12H14N2OS2 — CID 102748197
3-[4-(3-methylthiophen-2-yl)-1,3-thiazol-2-yl]morpholine (PubChem CID 102748197) has the molecular formula C12H14N2OS2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 3-[4-(3-methylthiophen-2-yl)-1,3-thiazol-2-yl]morpholine.
| Compound Name | 3-[4-(3-methylthiophen-2-yl)-1,3-thiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 102748197 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-[4-(3-methylthiophen-2-yl)-1,3-thiazol-2-yl]morpholine |
| SMILES | Cc1ccsc1-c1csc(C2COCCN2)n1 |
| InChI | InChI=1S/C12H14N2OS2/c1-8-2-5-16-11(8)10-7-17-12(14-10)9-6-15-4-3-13-9/h2,5,7,9,13H,3-4,6H2,1H3 |
| InChIKey | YSOPVELFGRMXIY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |