C17H19N3O2S — CID 154746717
1-[4-(2-morpholin-3-yl-1,3-thiazol-4-yl)phenyl]pyrrolidin-2-one (PubChem CID 154746717) has the molecular formula C17H19N3O2S and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-[4-(2-morpholin-3-yl-1,3-thiazol-4-yl)phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-(2-morpholin-3-yl-1,3-thiazol-4-yl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 154746717 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-[4-(2-morpholin-3-yl-1,3-thiazol-4-yl)phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccc(-c2csc(C3COCCN3)n2)cc1 |
| InChI | InChI=1S/C17H19N3O2S/c21-16-2-1-8-20(16)13-5-3-12(4-6-13)15-11-23-17(19-15)14-10-22-9-7-18-14/h3-6,11,14,18H,1-2,7-10H2 |
| InChIKey | BFSMOXNFZCCXDA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |