C16H19N3OS — CID 9420097
1-[4-[2-(propylamino)-1,3-thiazol-4-yl]phenyl]pyrrolidin-2-one (PubChem CID 9420097) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 1-[4-[2-(propylamino)-1,3-thiazol-4-yl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[2-(propylamino)-1,3-thiazol-4-yl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 9420097 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-[4-[2-(propylamino)-1,3-thiazol-4-yl]phenyl]pyrrolidin-2-one |
| SMILES | CCCNc1nc(-c2ccc(N3CCCC3=O)cc2)cs1 |
| InChI | InChI=1S/C16H19N3OS/c1-2-9-17-16-18-14(11-21-16)12-5-7-13(8-6-12)19-10-3-4-15(19)20/h5-8,11H,2-4,9-10H2,1H3,(H,17,18) |
| InChIKey | QWDQZYBJOLLLAP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |