C12H19ClN2OS — CID 120581945
3-(4-cyclopentyl-1,3-thiazol-2-yl)morpholine;hydrochloride (PubChem CID 120581945) has the molecular formula C12H19ClN2OS and a molecular weight of 274.82 g/mol. Its IUPAC name is 3-(4-cyclopentyl-1,3-thiazol-2-yl)morpholine;hydrochloride.
| Compound Name | 3-(4-cyclopentyl-1,3-thiazol-2-yl)morpholine;hydrochloride |
|---|---|
| PubChem CID | 120581945 |
| Molecular Formula | C12H19ClN2OS |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 3-(4-cyclopentyl-1,3-thiazol-2-yl)morpholine;hydrochloride |
| SMILES | Cl.c1sc(C2COCCN2)nc1C1CCCC1 |
| InChI | InChI=1S/C12H18N2OS.ClH/c1-2-4-9(3-1)11-8-16-12(14-11)10-7-15-6-5-13-10;/h8-10,13H,1-7H2;1H |
| InChIKey | LHDHXLHNNYIMQC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |