C19H14F3NOS — CID 143872478
2-[[4-(oxiran-2-yl)phenyl]methyl]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazole (PubChem CID 143872478) has the molecular formula C19H14F3NOS and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-[[4-(oxiran-2-yl)phenyl]methyl]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazole.
| Compound Name | 2-[[4-(oxiran-2-yl)phenyl]methyl]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 143872478 |
| Molecular Formula | C19H14F3NOS |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-[[4-(oxiran-2-yl)phenyl]methyl]-4-[3-(trifluoromethyl)phenyl]-1,3-thiazole |
| SMILES | FC(F)(F)c1cccc(-c2csc(Cc3ccc(C4CO4)cc3)n2)c1 |
| InChI | InChI=1S/C19H14F3NOS/c20-19(21,22)15-3-1-2-14(9-15)16-11-25-18(23-16)8-12-4-6-13(7-5-12)17-10-24-17/h1-7,9,11,17H,8,10H2 |
| InChIKey | CIJMUKCWSRICHX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|