C17H13F3N2S — CID 163208092
4-[2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-4-yl]aniline (PubChem CID 163208092) has the molecular formula C17H13F3N2S and a molecular weight of 334.37 g/mol. Its IUPAC name is 4-[2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-4-yl]aniline.
| Compound Name | 4-[2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 163208092 |
| Molecular Formula | C17H13F3N2S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 4-[2-[[4-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-4-yl]aniline |
| SMILES | Nc1ccc(-c2csc(Cc3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C17H13F3N2S/c18-17(19,20)13-5-1-11(2-6-13)9-16-22-15(10-23-16)12-3-7-14(21)8-4-12/h1-8,10H,9,21H2 |
| InChIKey | NZURARFXRBLBNV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|