C17H14N2O2S — CID 82154926
4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]methyl]benzoic acid (PubChem CID 82154926) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 82154926 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]methyl]benzoic acid |
| SMILES | Nc1cccc(-c2csc(Cc3ccc(C(=O)O)cc3)n2)c1 |
| InChI | InChI=1S/C17H14N2O2S/c18-14-3-1-2-13(9-14)15-10-22-16(19-15)8-11-4-6-12(7-5-11)17(20)21/h1-7,9-10H,8,18H2,(H,20,21) |
| InChIKey | JPEZUKOIXQPVEL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|