C15H12N2O3S — CID 82154935
5-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]methyl]furan-2-carboxylic acid (PubChem CID 82154935) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is 5-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 82154935 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 5-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]methyl]furan-2-carboxylic acid |
| SMILES | Nc1cccc(-c2csc(Cc3ccc(C(=O)O)o3)n2)c1 |
| InChI | InChI=1S/C15H12N2O3S/c16-10-3-1-2-9(6-10)12-8-21-14(17-12)7-11-4-5-13(20-11)15(18)19/h1-6,8H,7,16H2,(H,18,19) |
| InChIKey | WGCKBLIFBDIJSW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|