C8H12N2S2 — CID 82397404
3-(2-methyl-1,3-thiazol-4-yl)thiomorpholine (PubChem CID 82397404) has the molecular formula C8H12N2S2 and a molecular weight of 200.33 g/mol. Its IUPAC name is 3-(2-methyl-1,3-thiazol-4-yl)thiomorpholine.
| Compound Name | 3-(2-methyl-1,3-thiazol-4-yl)thiomorpholine |
|---|---|
| PubChem CID | 82397404 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 3-(2-methyl-1,3-thiazol-4-yl)thiomorpholine |
| SMILES | Cc1nc(C2CSCCN2)cs1 |
| InChI | InChI=1S/C8H12N2S2/c1-6-10-8(5-12-6)7-4-11-3-2-9-7/h5,7,9H,2-4H2,1H3 |
| InChIKey | GYWFRCIYTGTZHQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |