C8H12N2OS — CID 105441296
2-methyl-5-thiomorpholin-3-yl-1,3-oxazole (PubChem CID 105441296) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-methyl-5-thiomorpholin-3-yl-1,3-oxazole.
| Compound Name | 2-methyl-5-thiomorpholin-3-yl-1,3-oxazole |
|---|---|
| PubChem CID | 105441296 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-methyl-5-thiomorpholin-3-yl-1,3-oxazole |
| SMILES | Cc1ncc(C2CSCCN2)o1 |
| InChI | InChI=1S/C8H12N2OS/c1-6-10-4-8(11-6)7-5-12-3-2-9-7/h4,7,9H,2-3,5H2,1H3 |
| InChIKey | GYXDOGZPYRQGCI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |