C10H11N3OS — CID 83871240
2-thiomorpholin-3-yl-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 83871240) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-thiomorpholin-3-yl-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2-thiomorpholin-3-yl-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 83871240 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 2-thiomorpholin-3-yl-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | c1cnc2nc(C3CSCCN3)oc2c1 |
| InChI | InChI=1S/C10H11N3OS/c1-2-8-9(12-3-1)13-10(14-8)7-6-15-5-4-11-7/h1-3,7,11H,4-6H2 |
| InChIKey | JWQLNYMEBFJEGE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |