C11H11ClN2OS — CID 82905260
7-chloro-2-thiomorpholin-3-yl-1,3-benzoxazole (PubChem CID 82905260) has the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. Its IUPAC name is 7-chloro-2-thiomorpholin-3-yl-1,3-benzoxazole.
| Compound Name | 7-chloro-2-thiomorpholin-3-yl-1,3-benzoxazole |
|---|---|
| PubChem CID | 82905260 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 7-chloro-2-thiomorpholin-3-yl-1,3-benzoxazole |
| SMILES | Clc1cccc2nc(C3CSCCN3)oc12 |
| InChI | InChI=1S/C11H11ClN2OS/c12-7-2-1-3-8-10(7)15-11(14-8)9-6-16-5-4-13-9/h1-3,9,13H,4-6H2 |
| InChIKey | MYFWYAUAGUDEHA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |